CAS 1012067-93-4

Benzoic acid, 2-amino-5-[(7-ethoxy-7-oxoheptyl)oxy]-4-methoxy-, ethyl ester

Description:

Benzoic acid, 2-amino-5-[(7-ethoxy-7-oxoheptyl)oxy]-4-methoxy-, ethyl ester, identified by the CAS number 1012067-93-4, is a complex organic compound characterized by its functional groups and structural features. It contains a benzoic acid moiety, which contributes to its acidity and potential for forming salts or esters. The presence of an amino group indicates that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The ethyl ester functionality suggests that it can undergo hydrolysis to yield the corresponding acid. Additionally, the compound features a long aliphatic chain with an ethoxy and keto group, which may influence its solubility and lipophilicity, making it potentially useful in pharmaceutical applications or as a surfactant. Its methoxy group can also enhance its stability and modify its reactivity. Overall, this compound's unique structure may impart specific biological activities or properties, warranting further investigation for potential applications in medicinal chemistry or materials science.

Formula: C₁₉H₂₉NO₆

InChI: InChI=1S/C19H29NO6/c1-4-24-18(21)10-8-6-7-9-11-26-17-12-14(19(22)25-5-2)15(20)13-16(17)23-3/h12-13H,4-11,20H2,1-3H3

InChI key: InChIKey=TZALXVPCJMHBGP-UHFFFAOYSA-N

SMILES: O(CCCCCCC(OCC)=O)C1=C(OC)C=C(N)C(C(OCC)=O)=C1

Synonyms:

• Ethyl 2-amino-5-(7-ethoxy-7-oxoheptyloxy)-4-methoxybenzoate
• Benzoic acid, 2-amino-5-[(7-ethoxy-7-oxoheptyl)oxy]-4-methoxy-, ethyl ester

Ethyl 2-amino-5-((7-ethoxy-7-oxoheptyl)oxy)-4-methoxybenzoate

CAS: 1012067-93-4

Formula: C₁₉H₂₉NO₆

Molecular weight: 367.4367

Ref: IN-DA0003YV