CAS 1012084-53-5

5-Bromo-2-fluoro-3-Pyridinol

Description:

5-Bromo-2-fluoro-3-pyridinol is a heterocyclic organic compound characterized by its pyridine ring, which contains both bromine and fluorine substituents. The presence of the bromine atom at the 5-position and the fluorine atom at the 2-position contributes to its unique reactivity and potential applications in medicinal chemistry and agrochemicals. This compound features a hydroxyl group (-OH) at the 3-position, which enhances its polarity and solubility in polar solvents. The molecular structure allows for various interactions, making it a candidate for further functionalization or as an intermediate in synthetic pathways. Its properties, such as boiling point, melting point, and solubility, are influenced by the electronegative halogen atoms, which can affect the compound's overall stability and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks.

Formula: C₅H₃BrFNO

InChI: InChI=1S/C5H3BrFNO/c6-3-1-4(9)5(7)8-2-3/h1-2,9H

SMILES: c1c(cnc(c1O)F)Br

Synonyms:

• 5-Bromo-2-fluoropyridin-3-ol
• 5-Bromo-2-fluoropyridinyl-3-ol
• 5-bromo-2-fluoro-3-pyridine
• 5-Bromo-2-fluoro-3-Pyridinol
• 3-Pyridinol, 5-bromo-2-fluoro-
• 5-Bromo-2-fluoro-3-hydroxypyridine 98%

3-Pyridinol, 5-bromo-2-fluoro-

CAS: 1012084-53-5

Formula: C₅H₃BrFNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.9858

Ref: IN-DA0003YU

5-Bromo-2-fluoro-3-hydroxypyridine

CAS: 1012084-53-5

5-Bromo-2-fluoro-3-hydroxypyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.99g/mol

Ref: 54-PC51114

5-Bromo-2-fluoropyridin-3-ol

CAS: 1012084-53-5

Formula: C₅H₃BrFNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.987

Ref: 10-F325188

2-Fluoro-3-hydroxy-5-bromopyridine

CAS: 1012084-53-5

Versatile small molecule scaffold

Formula: C₅H₃BrFNO

Purity: Min. 95%

Molecular weight: 191.99 g/mol

Ref: 3D-MQB08453