CAS 101219-69-6
:4-[(1R)-1-Hydroxyethyl]benzonitrile
Description:
4-[(1R)-1-Hydroxyethyl]benzonitrile, with the CAS number 101219-69-6, is an organic compound characterized by the presence of a benzonitrile moiety substituted with a hydroxyethyl group. This compound features a benzene ring attached to a nitrile group (–C≡N) and a hydroxyl group (–OH) on a carbon chain that is also connected to the benzene. The presence of the hydroxyethyl group indicates that it has both hydrophilic and hydrophobic characteristics, which can influence its solubility in various solvents. The compound is likely to exhibit moderate polarity due to the hydroxyl group, while the nitrile group contributes to its potential reactivity and ability to participate in various chemical reactions, such as nucleophilic additions. Additionally, the stereochemistry indicated by the (1R) configuration suggests specific spatial arrangements that may affect its biological activity and interactions. Overall, this compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific uses would depend on further research and development.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c1-7(11)9-4-2-8(6-10)3-5-9/h2-5,7,11H,1H3/t7-/m1/s1
InChI key:InChIKey=XGAVOODMMBMCKV-SSDOTTSWSA-N
SMILES:[C@H](C)(O)C1=CC=C(C#N)C=C1
Synonyms:- (R)-1-(4-Cyanophenyl)ethanol
- (R)-1-(4-Isocyanophenyl)Ethano
- (R)-1-(4-Isocyanophenyl)Ethanol
- (R)-4-(1-Hydroxyethyl)benzonitrile
- (αR)-4-Cyano-α-methylbenzenemethanol
- 4-((R)-1-Hydroxyethyl)benzonitrile
- 4-[(1R)-1-hydroxyethyl]benzonitrile
- Benzonitrile, 4-(1-hydroxyethyl)-, (R)-
- Benzonitrile, 4-[(1R)-1-hydroxyethyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzonitrile, 4-[(1R)-1-hydroxyethyl]-
CAS:Formula:C9H9NOPurity:95%Color and Shape:LiquidMolecular weight:147.1739(R)-4-(1-Hydroxyethyl)benzonitrile
CAS:(R)-4-(1-Hydroxyethyl)benzonitrilePurity:98%Molecular weight:147.17g/mol(R)-4-(1-Hydroxyethyl)benzonitrile
CAS:4-(1-Hydroxyethyl)benzonitrile (1HBE) is a natural product that is extracted from the plant Polygonum perfoliatum. It has been shown to have antitumor activity against a number of tumor cell lines in vitro and in vivo. The antitumor activity of 1HBE is due to its ability to inhibit the proliferation of cancer cells by binding to DNA nucleotides and preventing their synthesis. 1HBE also inhibits the production of ribosomes, which are needed for protein synthesis. 1HBE has been prepared on a small scale using chromatographic methods. Preparation requires extracting the polygonum plants with ethanol, followed by steam distillation, concentration, and purification.Formula:C9H9NOPurity:Min. 95%Molecular weight:147.17 g/mol



