CymitQuimica logo

CAS 101221-66-3

:

(4E)-1,1,1-trifluoro-4-phenyl-4-[(E)-[4,4,4-trifluoro-3-hydroxy-1-phen yl-3-(trifluoromethyl)butylidene]hydrazinylidene]-2-(trifluoromethyl)b utan-2-ol

Description:
The chemical substance with the name "(4E)-1,1,1-trifluoro-4-phenyl-4-[(E)-[4,4,4-trifluoro-3-hydroxy-1-phenyl-3-(trifluoromethyl)butylidene]hydrazinylidene]-2-(trifluoromethyl)butan-2-ol" and CAS number "101221-66-3" is characterized by its complex structure, which includes multiple functional groups and fluorinated moieties. The presence of trifluoromethyl groups suggests significant lipophilicity and potential biological activity, as fluorinated compounds often exhibit unique pharmacokinetic properties. The hydrazine linkage indicates potential reactivity, particularly in forming hydrazones or undergoing oxidation. Additionally, the compound's phenyl groups contribute to its aromatic character, which may influence its stability and interaction with biological targets. The hydroxyl group suggests the potential for hydrogen bonding, which can affect solubility and reactivity. Overall, this compound's intricate structure and functional diversity may render it of interest in medicinal chemistry and materials science, although specific applications would depend on further research into its properties and behavior in various environments.
Formula:C22H16F12N2O2
InChI:InChI=1/C22H16F12N2O2/c23-19(24,25)17(37,20(26,27)28)11-15(13-7-3-1-4-8-13)35-36-16(14-9-5-2-6-10-14)12-18(38,21(29,30)31)22(32,33)34/h1-10,37-38H,11-12H2/b35-15-,36-16-
SMILES:c1ccc(cc1)/C(=N\N=C(\CC(C(F)(F)F)(C(F)(F)F)O)/c1ccccc1)/CC(C(F)(F)F)(C(F)(F)F)O
Synonyms:
  • Butyrophenone, 3-hydroxy-4,4,4-trifluoro-3-trifluoromethyl-, azine
  • 3-Hydroxy-4,4,4-trifluoro-3-trifluoromethylbutyrophenone azine
  • 4,4,4-Trifluoro-3-hydroxy-3-trifluoromethyl butyrophenone azine
  • (4Z,4'Z)-4,4'-(1Z,2Z)-hydrazine-1,2-diylidenebis[1,1,1-trifluoro-4-phenyl-2-(trifluoromethyl)butan-2-ol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.