CAS 101224-43-5
:6-(Trimethylsilyl)-5-hexynoic acid
Description:
6-(Trimethylsilyl)-5-hexynoic acid is an organic compound characterized by its unique structure, which includes a hexynoic acid backbone with a trimethylsilyl group attached. This compound features a terminal alkyne functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in various chemical reactions, particularly in the field of synthetic organic chemistry. Additionally, the carboxylic acid functional group allows for further derivatization, enabling the formation of esters or amides. Its molecular structure also suggests potential applications in materials science and pharmaceuticals, where the alkyne moiety can participate in click chemistry or other coupling reactions. Overall, 6-(Trimethylsilyl)-5-hexynoic acid is a versatile compound with significant implications in chemical research and development.
Formula:C9H16O2Si
InChI:InChI=1S/C9H16O2Si/c1-12(2,3)8-6-4-5-7-9(10)11/h4-5,7H2,1-3H3,(H,10,11)
InChI key:InChIKey=TWGUMGCDHHROIM-UHFFFAOYSA-N
SMILES:C(CCCC(O)=O)#C[Si](C)(C)C
Synonyms:- 6-(Trimethylsilyl)-5-hexynoic acid
- 5-Hexynoic acid, 6-(trimethylsilyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
