CymitQuimica logo

CAS 101234-76-8

:

4,5,6,7-Tetrahydro-4-thioxo-1H-cyclopenta[b]pyridine-1-acetic acid

Description:
4,5,6,7-Tetrahydro-4-thioxo-1H-cyclopenta[b]pyridine-1-acetic acid is a heterocyclic compound characterized by its unique bicyclic structure, which includes a pyridine ring fused to a cyclopentane framework. This compound features a thioxo group, contributing to its reactivity and potential biological activity. The presence of the acetic acid moiety suggests that it may exhibit acidic properties, which can influence its solubility and interaction with biological systems. Typically, compounds of this nature may be investigated for their pharmacological properties, including potential antimicrobial or anti-inflammatory effects. The molecular structure allows for various functional group interactions, making it a candidate for further chemical modifications. Its CAS number, 101234-76-8, serves as a unique identifier in chemical databases, facilitating research and communication regarding its properties and applications. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with implications in medicinal chemistry and drug development.
Formula:C10H11NO2S
InChI:InChI=1S/C10H11NO2S/c12-10(13)6-11-5-4-9(14)7-2-1-3-8(7)11/h4-5H,1-3,6H2,(H,12,13)
InChI key:InChIKey=HVOZESMPGJIRLF-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C2=C(C(=S)C=C1)CCC2
Synonyms:
  • 1H-1-Pyrindine-1-acetic acid, 4,5,6,7-tetrahydro-4-thioxo-
  • 4,5,6,7-Tetrahydro-4-thioxo-1H-cyclopenta[b]pyridine-1-acetic acid
  • 1H-Cyclopenta[b]pyridine-1-acetic acid, 4,5,6,7-tetrahydro-4-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.