CAS 101236-51-5
:Kushenol M
Description:
Kushenol M, identified by its CAS number 101236-51-5, is a chemical compound derived from the traditional Chinese medicinal herb Sophora flavescens. It belongs to the class of flavonoids, which are known for their diverse biological activities. Kushenol M exhibits anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. The compound's structure features a flavone backbone, which contributes to its ability to interact with various biological targets. Additionally, Kushenol M has been studied for its effects on cellular signaling pathways, suggesting potential therapeutic applications in treating inflammatory diseases and certain types of cancer. Its solubility and stability in different solvents can vary, influencing its bioavailability and efficacy in biological systems. As research continues, the full spectrum of its pharmacological effects and mechanisms of action is being explored, highlighting its potential as a valuable compound in natural product chemistry and drug development.
Formula:C30H36O7
InChI:InChI=1S/C30H36O7/c1-15(2)7-9-18(17(5)6)13-22-25(33)21(11-8-16(3)4)26(34)24-27(35)28(36)30(37-29(22)24)20-12-10-19(31)14-23(20)32/h7-8,10,12,14,18,28,30-34,36H,5,9,11,13H2,1-4,6H3/t18-,28+,30-/m1/s1
InChI key:InChIKey=AMIPWEKLJVRITL-XRRXVPKJSA-N
SMILES:C([C@@H](CC=C(C)C)C(C)=C)C1=C2C(=C(O)C(CC=C(C)C)=C1O)C(=O)[C@H](O)[C@H](O2)C3=C(O)C=C(O)C=C3
Synonyms:- 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-6-(3-methyl-2-butenyl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexenyl]-, (2R,3R)-
- 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-6-(3-methyl-2-buten-1-yl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-, (2R,3R)-
- Kushenol M
- 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-6-(3-methyl-2-butenyl)-8-[5-methyl-2-(1-methylethenyl)-4-hexenyl]-, [2R-[2α,3β,8(R*)]]-
- (2R,3R)-2-(2,4-Dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-6-(3-methyl-2-buten-1-yl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-4H-1-benzopyran-4-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Kushenol M
CAS:Kushenol M is a natural product of Sophora, Fabaceae.Formula:C30H36O7Purity:98%Color and Shape:SolidMolecular weight:508.6Kushenol M
CAS:Kushenol M is a peptide that activates the nicotinic acetylcholine receptor (nAChR) at the neuromuscular junction. Kushenol M binds to and opens the nAChR ion channels, which leads to depolarization of muscle cells and an influx of sodium ions into the cell. This causes an increase in muscle contraction. Kushenol M is used as a research tool to study the function of nAChRs in cell biology and physiology. It can also be used as an inhibitor for certain ion channel receptors.
Formula:C30H36O7Purity:Min. 95%Molecular weight:508.6 g/mol

