CAS 10125-76-5
:4-Nitroso-1,1′-biphenyl
Description:
4-Nitroso-1,1′-biphenyl, with the CAS number 10125-76-5, is an organic compound characterized by the presence of a nitroso group (-NO) attached to a biphenyl structure. This compound typically appears as a yellow to orange solid and is known for its aromatic properties due to the biphenyl framework. It is relatively stable under standard conditions but can undergo reactions typical of nitroso compounds, such as reduction to amines or oxidation to nitro compounds. The presence of the nitroso group can also impart unique reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in dye production and in organic synthesis. Additionally, 4-nitroso-1,1′-biphenyl may exhibit specific biological activities, which can be of interest in medicinal chemistry. However, handling this compound requires caution due to potential toxicity and environmental concerns associated with nitroso compounds. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C12H9NO
InChI:InChI=1S/C12H9NO/c14-13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H
InChI key:InChIKey=LLRWRZXFCFYZCL-UHFFFAOYSA-N
SMILES:N(=O)C1=CC=C(C=C1)C2=CC=CC=C2
Synonyms:- 4-Nitrosobiphenyl
- 1,1′-Biphenyl, 4-nitroso-
- 1-Nitroso-4-phenylbenzene
- 4-Nitroso-1,1′-biphenyl
- Biphenyl, 4-nitroso-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
