
CAS 101250-55-9
:2-Pyrrolidinemethanol, 1-(chloroacetyl)-, (2S)-
Description:
2-Pyrrolidinemethanol, 1-(chloroacetyl)-, (2S)-, with CAS number 101250-55-9, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a chloroacetyl group, which contributes to its reactivity and potential applications in organic synthesis. The (2S) designation indicates that it has a specific stereochemistry, which can influence its biological activity and interactions with other molecules. Typically, compounds of this nature may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential reactivity with nucleophiles due to the presence of the chloroacetyl moiety. Its structural features suggest potential uses in medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in the synthesis of more complex organic compounds. As with many chemical substances, safety and handling precautions should be observed due to the presence of reactive functional groups.
Formula:C7H12ClNO2
InChI:InChI=1S/C7H12ClNO2/c8-4-7(11)9-3-1-2-6(9)5-10/h6,10H,1-5H2/t6-/m0/s1
InChI key:InChIKey=XETXUGKVAYFLDB-LURJTMIESA-N
SMILES:C(CCl)(=O)N1[C@H](CO)CCC1
Synonyms:- (S)-2-Chloro-1-(2-hydroxymethylpyrrolidin-1-yl)ethanone
- 2-Pyrrolidinemethanol, 1-(chloroacetyl)-, (S)-
- 2-Pyrrolidinemethanol, 1-(chloroacetyl)-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.