
CAS 101251-13-2
:2-Chloro-4-ethyl-5-nitropyridine
Description:
2-Chloro-4-ethyl-5-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which contains a chlorine atom, an ethyl group, and a nitro group at specific positions. The presence of the chlorine atom at the 2-position and the nitro group at the 5-position contributes to its reactivity and potential applications in various chemical syntheses. The ethyl group at the 4-position enhances the compound's hydrophobicity and can influence its biological activity. This compound is typically a yellow to brown solid and is soluble in organic solvents. It is often used in the synthesis of pharmaceuticals and agrochemicals due to its ability to participate in electrophilic substitution reactions. Additionally, the nitro group can serve as a functional handle for further chemical modifications. Safety precautions should be observed when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards.
Formula:C7H7ClN2O2
InChI:InChI=1S/C7H7ClN2O2/c1-2-5-3-7(8)9-4-6(5)10(11)12/h3-4H,2H2,1H3
InChI key:InChIKey=UPCPWQBNVJOZLN-UHFFFAOYSA-N
SMILES:C(C)C=1C(N(=O)=O)=CN=C(Cl)C1
Synonyms:- Pyridine, 2-chloro-4-ethyl-5-nitro-
- 2-Chloro-4-ethyl-5-nitropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.