CAS 101257-38-9

THIAZOLE-4-CARBOXYLIC ACID HYDRAZIDE

Description:

Thiazole-4-carboxylic acid hydrazide is an organic compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group and a hydrazide moiety, which contributes to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the hydrazide group suggests potential for forming hydrazones and other derivatives, which can be explored for their pharmacological properties. Additionally, thiazole derivatives are known for their diverse biological activities, including antimicrobial and anti-inflammatory effects. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential toxicity or reactivity. Overall, thiazole-4-carboxylic acid hydrazide represents a valuable compound in the field of chemical research and development.

Formula: C₄H₅N₃OS

InChI: InChI=1/C4H5N3OS/c5-7-4(8)3-1-9-2-6-3/h1-2H,5H2,(H,7,8)

SMILES: c1c(C(=NN)O)ncs1

Synonyms:

• 4-Thiazolecarboxylicacid,hydrazide(6CI,9CI)
• 1,3-Thiazole-4-Carbohydrazide

4-Thiazolecarboxylic acid, hydrazide

CAS: 101257-38-9

Formula: C₄H₅N₃OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.1670

Ref: IN-DA00043D

Thiazole-4-carbohydrazide

CAS: 101257-38-9

Thiazole-4-carbohydrazide

Purity: 98%

Molecular weight: 143.17g/mol

Ref: 54-OR300049

Thiazole-4-carbohydrazide

CAS: 101257-38-9

Formula: C₄H₅N₃OS

Purity: 98%

Molecular weight: 143.16

Ref: 10-F224282