CAS 101258-10-0

2-Methyl-6,7-benzothiazolediamine

Description:

2-Methyl-6,7-benzothiazolediamine, with the CAS number 101258-10-0, is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features two amine groups (-NH2) and a methyl group (-CH3) attached to the benzothiazole framework, contributing to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amine groups. The compound is of interest in various fields, including materials science and organic synthesis, due to its potential as a building block for dyes, pigments, or pharmaceuticals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is handled. Safety data should be consulted to understand its toxicity and handling precautions, as compounds with amine functionalities can pose health risks.

Formula: C₈H₉N₃S

InChI: InChI=1S/C8H9N3S/c1-4-11-6-3-2-5(9)7(10)8(6)12-4/h2-3H,9-10H2,1H3

InChI key: InChIKey=RBFVCKBGMGPJIT-UHFFFAOYSA-N

SMILES: NC1=C2C(N=C(C)S2)=CC=C1N

Synonyms:

• 6,7-Benzothiazolediamine, 2-methyl-
• 2-Methyl-6,7-benzothiazolediamine
• 2-Methyl-1,3-benzothiazole-6,7-diamine
• Benzothiazole, 6,7-diamino-2-methyl-