CAS 101258-12-2
:3-(1-Methyl-1H-tetrazol-5-yl)aniline
Description:
3-(1-Methyl-1H-tetrazol-5-yl)aniline, with the CAS number 101258-12-2, is an organic compound characterized by the presence of both an aniline group and a tetrazole moiety. The structure features a benzene ring substituted with an amino group (aniline) and a tetrazole ring, which is a five-membered heterocyclic compound containing four nitrogen atoms and one carbon atom. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The tetrazole ring contributes to its unique chemical reactivity and properties, making it a subject of interest in medicinal chemistry. Additionally, the presence of the methyl group on the tetrazole enhances its lipophilicity, which can influence its biological activity and interaction with various targets. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles.
Formula:C8H9N5
InChI:InChI=1/C8H9N5/c1-13-8(10-11-12-13)6-3-2-4-7(9)5-6/h2-5H,9H2,1H3
SMILES:Cn1c(c2cccc(c2)N)nnn1
Synonyms:- 1-Methyl-5-(3-aminophenyl)tetrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
