
CAS 10126-68-8
:Hexadecylketene dimer
Description:
Hexadecylketene dimer (CAS 10126-68-8) is a chemical compound primarily used in the production of paper and as a surfactant. It is a dimeric fatty acid derivative, characterized by its long hydrophobic hydrocarbon chain, which typically consists of 16 carbon atoms. This structure imparts significant hydrophobic properties, making it effective in enhancing the water resistance of paper products. Hexadecylketene dimer is known for its ability to react with cellulose fibers, forming covalent bonds that improve the strength and durability of paper. Additionally, it exhibits surfactant properties, which can aid in emulsifying and stabilizing formulations. The compound is generally stable under normal conditions but should be handled with care due to potential irritant effects on skin and eyes. Its applications extend beyond the paper industry, finding use in various formulations where water repellency and surface modification are desired. Overall, hexadecylketene dimer is valued for its functional properties in enhancing material performance in industrial applications.
Formula:C36H68O2
InChI:InChI=1S/C36H68O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-34(36(37)38-35)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h33-34H,3-32H2,1-2H3
InChI key:InChIKey=NGDLSKPZMOTRTR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCC)=C1C(CCCCCCCCCCCCCCCC)C(=O)O1
Synonyms:- 2-Oxetanone, 4-heptadecylidene-3-hexadecyl-
- 4-Heptadecylidene-3-hexadecyl-2-oxetanone
- Cetylketene dimer
- Hexadecylketene dimer
- 3-Eicosenoic acid, 2-hexadecyl-3-hydroxy-, β-lactone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
