CAS 101267-80-5
:3-Methoxy-2-(pentyloxy)benzaldehyde
Description:
3-Methoxy-2-(pentyloxy)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a methoxy group and a pentyloxy substituent on a benzaldehyde framework. The presence of the methoxy group (-OCH3) enhances the compound's solubility in organic solvents and can influence its reactivity and interaction with other molecules. The pentyloxy group, which consists of a five-carbon alkyl chain, contributes to the compound's hydrophobic characteristics, potentially affecting its physical properties such as boiling point and melting point. This compound may exhibit interesting chemical behavior due to the electron-donating effects of the methoxy group, which can stabilize certain reactive intermediates. Additionally, the aldehyde functional group (-CHO) is known for its reactivity in condensation reactions and can participate in various organic transformations. Overall, 3-Methoxy-2-(pentyloxy)benzaldehyde is a versatile compound that may find applications in organic synthesis, fragrance formulation, or as an intermediate in the production of more complex molecules.
Formula:C13H18O3
InChI:InChI=1S/C13H18O3/c1-3-4-5-9-16-13-11(10-14)7-6-8-12(13)15-2/h6-8,10H,3-5,9H2,1-2H3
InChI key:InChIKey=LJRAKVKOCXJVMH-UHFFFAOYSA-N
SMILES:O(CCCCC)C1=C(C=O)C=CC=C1OC
Synonyms:- 3-Methoxy-2-n-pentoxybenzaldehyde
- 3-Methoxy-2-(pentyloxy)benzaldehyde
- Benzaldehyde, 3-methoxy-2-(pentyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.