CAS 101268-36-4
:4-BUTOXY-3-ETHOXY-BENZOIC ACID
Description:
4-Butoxy-3-ethoxy-benzoic acid, identified by its CAS number 101268-36-4, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with butoxy and ethoxy groups. This compound typically exhibits properties associated with both hydrophobic and hydrophilic characteristics due to the presence of the long hydrocarbon chains and the carboxylic acid functional group. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, reflecting its amphiphilic nature. The presence of the butoxy and ethoxy groups can influence its reactivity, making it a potential candidate for applications in pharmaceuticals, agrochemicals, or as a surfactant. Additionally, the compound may exhibit specific biological activities, which could be of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C13H18O4
InChI:InChI=1/C13H18O4/c1-3-5-8-17-11-7-6-10(13(14)15)9-12(11)16-4-2/h6-7,9H,3-5,8H2,1-2H3,(H,14,15)
SMILES:CCCCOc1ccc(cc1OCC)C(=O)O
Synonyms:- 4-Butoxy-3-Ethoxybenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
