CAS 10127-36-3
:Brilliant Cresyl Blue BB
Description:
Brilliant Cresyl Blue (BB) is a synthetic dye and a member of the triphenylmethane dye family, primarily used as a biological stain. It is characterized by its vibrant blue color and is soluble in water and organic solvents, making it versatile for various applications. The compound is often utilized in histology and cytology for staining cell structures, particularly in the identification of viable and non-viable cells, as it can penetrate living cells and bind to cellular components. Its mechanism involves the selective staining of certain cellular organelles, which aids in visualizing cellular morphology under a microscope. Additionally, Brilliant Cresyl Blue is employed in biochemical assays, particularly in the assessment of cell viability and proliferation. While it is generally considered safe for laboratory use, appropriate safety measures should be taken to handle the dye, as with any chemical reagent. Overall, its distinctive staining properties and ease of use make it a valuable tool in various scientific research and diagnostic applications.
Formula:C17H21N4O·Cl
InChI:InChI=1S/C17H21N4O.ClH/c1-4-21(5-2)14-9-15-13(6-10(14)3)20-17-12(19)7-11(18)8-16(17)22-15;/h6-9H,4-5,18-19H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=XBFUWVRRUMSFPH-UHFFFAOYSA-M
SMILES:N(CC)(CC)C1=CC2=C(N=C3C(=[O+]2)C=C(N)C=C3N)C=C1C.[Cl-]
Synonyms:- Phenoxazin-5-ium, 1,3-diamino-7-(diethylamino)-8-methyl-, chloride (1:1)
- Phenoxazin-5-ium, 1,3-diamino-7-(diethylamino)-8-methyl-, chloride
- C.I. 51010
- Brilliant Cresyl Blue
- Brilliant Cresyl Blue BB
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.