CAS 101273-81-8

2-O-TOLYL-4H-ISOQUINOLINE-1,3-DIONE

Description:

2-O-Tolyl-4H-isoquinoline-1,3-dione, with the CAS number 101273-81-8, is a chemical compound that belongs to the class of isoquinoline derivatives. It features a fused ring system that includes an isoquinoline moiety and two carbonyl groups, contributing to its diketone structure. This compound is characterized by its aromatic nature, which often imparts stability and unique reactivity patterns. The presence of the tolyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. Isoquinoline derivatives are known for their diverse biological activities, including antimicrobial and anticancer properties, making this compound of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence properties, which can be useful in various analytical applications. Its synthesis typically involves multi-step organic reactions, and it may be utilized in research settings for the development of new pharmaceuticals or as a chemical probe in biological studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₆H₁₃NO₂

InChI: InChI=1/C16H13NO2/c1-11-6-2-5-9-14(11)17-15(18)10-12-7-3-4-8-13(12)16(17)19/h2-9H,10H2,1H3

SMILES: Cc1ccccc1N1C(=O)Cc2ccccc2C1=O

Synonyms:

• 2-(2-methylphenyl)isoquinoline-1,3(2H,4H)-dione

2-o-Tolyl-4H-isoquinoline-1,3-dione

CAS: 101273-81-8

Formula: C₁₆H₁₃NO₂

Color and Shape: Solid

Molecular weight: 251.2799

Ref: IN-DA00044G

2-(2-Methylphenyl)-1,2,3,4-tetrahydroisoquinoline-1,3-dione

Controlled Product

CAS: 101273-81-8

Applications 2-(2-methylphenyl)-1,2,3,4-tetrahydroisoquinoline-1,3-dione (cas# 101273-81-8) is a useful research chemical.

Formula: C₁₆H₁₃NO₂

Color and Shape: Neat

Molecular weight: 251.27

Ref: TR-B401218