CymitQuimica logo

CAS 10128-92-4

:

3-Pyridinecarboxamide,1,2-dihydro-2-oxo-(9CI)

Description:
3-Pyridinecarboxamide, 1,2-dihydro-2-oxo- (9CI), also known by its CAS number 10128-92-4, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxamide functional group, contributing to its polar nature and potential for hydrogen bonding. The presence of the 1,2-dihydro-2-oxo moiety indicates that it has a saturated structure with a carbonyl group, which can influence its reactivity and interactions with other molecules. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for various potential applications, including in medicinal chemistry and as intermediates in organic synthesis. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 3-Pyridinecarboxamide, 1,2-dihydro-2-oxo- is a versatile compound with significant implications in chemical and biological contexts.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c7-5(9)4-2-1-3-8-6(4)10/h1-3H,(H2,7,9)(H,8,10)
SMILES:c1cc(C(=O)N)c(nc1)O
Synonyms:
  • 3-Pyridinecarboxamide, 1,2-dihydro-2-oxo-
  • 2-Oxo-1,2-Dihydropyridine-3-Carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.