CAS 1012879-50-3
:1H-Indazole, 5-hydrazinyl-, hydrochloride (1:1)
Description:
1H-Indazole, 5-hydrazinyl-, hydrochloride (1:1) is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a hydrazinyl group at the 5-position introduces a hydrazine functional group, which is known for its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit properties such as potential anti-cancer or anti-inflammatory activities, although specific biological effects would depend on further studies. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as compounds containing hydrazine derivatives can be hazardous. Overall, 1H-Indazole, 5-hydrazinyl-, hydrochloride is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H8N4·ClH
InChI:InChI=1S/C7H8N4.ClH/c8-10-6-1-2-7-5(3-6)4-9-11-7;/h1-4,10H,8H2,(H,9,11);1H
InChI key:InChIKey=APSGXXUYIDEIGV-UHFFFAOYSA-N
SMILES:N(N)C=1C=C2C(=CC1)NN=C2.Cl
Synonyms:- (1H-Indazol-5-yl)hydrazine hydrochloride
- 1H-Indazole, 5-hydrazinyl-, hydrochloride (1:1)
- 1-(1H-Indazol-5-yl)hydrazine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
