CAS 10129-44-9
:Pyridinium, 1-(2-propen-1-yl)-, bromide (1:1)
Description:
Pyridinium, 1-(2-propen-1-yl)-, bromide (1:1), commonly referred to as allyl pyridinium bromide, is a quaternary ammonium salt characterized by its pyridinium cation and bromide anion. This compound features a pyridine ring substituted with an allyl group, which contributes to its reactivity and potential applications in organic synthesis. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the ionic nature of the bromide salt. The presence of the allyl group allows for various chemical transformations, making it useful in synthetic organic chemistry, particularly in reactions involving nucleophilic substitutions or as a reagent in the formation of other organic compounds. Additionally, its quaternary ammonium structure may impart surfactant properties, which can be beneficial in certain applications. Safety data should be consulted, as with all chemical substances, to ensure proper handling and usage in laboratory settings.
Formula:C8H10N·Br
InChI:InChI=1S/C8H10N.BrH/c1-2-6-9-7-4-3-5-8-9;/h2-5,7-8H,1,6H2;1H/q+1;/p-1
InChI key:InChIKey=KLCKMAMMLDRAQP-UHFFFAOYSA-M
SMILES:C(C=C)[N+]=1C=CC=CC1.[Br-]
Synonyms:- 1-Allylpyridinium bromide
- Pyridinium, 1-(2-propenyl)-, bromide
- N-Allylpyridinium bromide
- Pyridinium, 1-(2-propen-1-yl)-, bromide (1:1)
- Pyridinium, 1-allyl-, bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
