CAS 1013-00-9
:2,3-dichloro-2,3-dihydronaphthalene-1,4-dione
Description:
2,3-Dichloro-2,3-dihydronaphthalene-1,4-dione, with the CAS number 1013-00-9, is a chemical compound that belongs to the class of naphthoquinones. It features a naphthalene backbone with two chlorine substituents and a diketone functional group, which contributes to its reactivity and potential applications in organic synthesis. This compound is typically characterized by its solid state at room temperature and exhibits a distinct color, often ranging from yellow to orange, due to its conjugated system. It is known for its ability to undergo various chemical reactions, including reduction and substitution, making it useful in the synthesis of other organic compounds. Additionally, 2,3-dichloro-2,3-dihydronaphthalene-1,4-dione may exhibit biological activity, which has been explored in various studies. However, handling this compound requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures in laboratory settings.
Formula:C10H6Cl2O2
InChI:InChI=1/C10H6Cl2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4,7-8H
Synonyms:- 1,4-Naphthoquinone, 2,3-dichloro-2,3-dihydro-
- 1,4-naphthalenedione, 2,3-dichloro-2,3-dihydro-
- 2,3-Dichloro-2,3-dihydronaphthalene-1,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
