CAS 1013-22-5
:1-(2,3-Dimethylphenyl)piperazine
Description:
1-(2,3-Dimethylphenyl)piperazine, with the CAS number 1013-22-5, is an organic compound that belongs to the class of piperazines, which are characterized by a six-membered ring containing two nitrogen atoms. This particular compound features a piperazine ring substituted with a 2,3-dimethylphenyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and is known for its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. The presence of the dimethylphenyl group can influence its lipophilicity and interaction with biological targets, making it of interest in drug development. Additionally, 1-(2,3-Dimethylphenyl)piperazine may exhibit various functional properties, including potential psychoactive effects, which have led to investigations into its mechanism of action and therapeutic applications. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C12H18N2
InChI:InChI=1S/C12H18N2/c1-10-4-3-5-12(11(10)2)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3
InChI key:InChIKey=LIKXJDINUMWKQA-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1C)N2CCNCC2
Synonyms:- (2,3-Dimethylphenyl)-piperidine
- 1-(2,3-Xylyl)piperazine
- 2-Hydrazinylquinoline
- 4-(2,3-Dimethylphenyl)Piperazin-1-Ium
- 4-(2,3-Dimethylphenyl)piperazine
- N-(2,3-Dimethylphenyl)piperazine
- Piperazine, 1-(2,3-dimethylphenyl)-
- Piperazine, 1-(2,3-xylyl)-
- 1-(2,3-Dimethylphenyl)piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Piperazine, 1-(2,3-dimethylphenyl)-
CAS:Formula:C12H18N2Purity:98%Color and Shape:LiquidMolecular weight:190.28471-(2,3-Dimethylphenyl)-piperazine-D8
CAS:Controlled ProductFormula:C12D8H10N2Color and Shape:NeatMolecular weight:198.3341-(2,3-Dimethylphenyl)piperazine
CAS:Controlled Product<p>1-(2,3-Dimethylphenyl)piperazine is a piperidine derivative that has been shown to have antidepressant activity in both in vitro and in vivo studies. It acts as an antagonist at the 5-HT1A receptor and as an agonist at the 5-HT2A receptor. 1-(2,3-Dimethylphenyl)piperazine has been shown to inhibit the production of dopamine, serotonin, and citric acid by inhibiting the enzyme citrate synthase. This drug also increases the concentration of chloride ions in cells. 1-(2,3-Dimethylphenyl)piperazine is used to treat depression, anxiety disorders, and other conditions that may be related to chemical imbalances of serotonin.</p>Formula:C12H18N2Purity:Min. 95%Molecular weight:190.29 g/mol


