CAS 1013-37-2

N-(quinazolin-4-yl)ethane-1,2-diamine

Description:

N-(quinazolin-4-yl)ethane-1,2-diamine, with the CAS number 1013-37-2, is an organic compound characterized by its structure, which includes a quinazoline moiety and an ethane-1,2-diamine group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as potential basicity due to the presence of amino groups. It may display moderate solubility in polar solvents, influenced by the amino groups that can engage in hydrogen bonding. The quinazoline ring contributes to its stability and may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its potential applications could span pharmaceuticals, where it may serve as a scaffold for drug development, particularly in targeting specific biological pathways. As with many amines, it is essential to handle this compound with care, considering its reactivity and potential health hazards.

Formula: C₁₀H₁₂N₄

InChI: InChI=1/C10H12N4/c11-5-6-12-10-8-3-1-2-4-9(8)13-7-14-10/h1-4,7H,5-6,11H2,(H,12,13,14)

SMILES: c1ccc2c(c1)c(=NCCN)[nH]cn2

N-(2-Aminoethyl)quinazolin-4-amine

CAS: 1013-37-2

Versatile small molecule scaffold

Formula: C₁₀H₁₂N₄

Purity: Min. 95%

Molecular weight: 188.23 g/mol

Ref: 3D-BAA01337