CAS 1013-66-7
:3,3-dimethyl-2-phenylmorpholine
Description:
3,3-Dimethyl-2-phenylmorpholine is an organic compound characterized by its morpholine structure, which includes a six-membered ring containing both nitrogen and oxygen atoms. The compound features two methyl groups attached to the third carbon of the morpholine ring and a phenyl group at the second carbon, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a distinctive odor. This substance is known for its applications in organic synthesis, particularly as a building block in the production of pharmaceuticals and agrochemicals. Its molecular structure imparts certain solubility characteristics, allowing it to dissolve in various organic solvents while being less soluble in water. Additionally, 3,3-dimethyl-2-phenylmorpholine may exhibit moderate toxicity, necessitating appropriate safety measures during handling and use. As with many morpholine derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, making it a versatile compound in synthetic organic chemistry.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c1-12(2)11(14-9-8-13-12)10-6-4-3-5-7-10/h3-7,11,13H,8-9H2,1-2H3
SMILES:CC1(C)C(c2ccccc2)OCCN1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.