CymitQuimica logo

CAS 1013-91-8

:

Silane, fluorodiphenyl-

Description:
Silane, fluorodiphenyl- (CAS 1013-91-8) is an organosilicon compound characterized by the presence of silicon bonded to two phenyl groups and a fluorine atom. This compound typically exhibits a colorless to pale yellow liquid form and is known for its low volatility and moderate stability under standard conditions. Its molecular structure allows for unique reactivity, particularly in the presence of moisture, where it can hydrolyze to form silanol compounds. Fluorodiphenyl silanes are often utilized in various applications, including as coupling agents in polymer chemistry, surface modifiers, and in the synthesis of advanced materials. The presence of fluorine enhances its chemical stability and hydrophobic properties, making it valuable in coatings and sealants. Additionally, due to its organofluorine nature, it may exhibit specific interactions with biological systems, necessitating careful handling and consideration of environmental impact. Overall, silane, fluorodiphenyl- is a versatile compound with significant implications in both industrial and research settings.
Formula:C12H11FSi
InChI:InChI=1S/C12H11FSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H
InChI key:InChIKey=BUFRPMIIXBOSDW-UHFFFAOYSA-N
SMILES:[SiH](F)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:
  • Fluorodiphenylsilane
  • Diphenylfluorosilane
  • Silane, fluorodiphenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.