CAS 10130-23-1
:2-methyl-3-phenylquinoxaline
Description:
2-Methyl-3-phenylquinoxaline is an organic compound characterized by its fused bicyclic structure, which consists of a quinoxaline core with a methyl group and a phenyl group attached. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties due to the presence of the phenyl group. It is relatively stable under standard conditions but may undergo reactions typical of quinoxaline derivatives, such as electrophilic substitution or reduction. The presence of the methyl and phenyl substituents can influence its solubility, reactivity, and potential applications in organic synthesis or as a building block in pharmaceuticals. Additionally, compounds like 2-methyl-3-phenylquinoxaline may exhibit interesting photophysical properties, making them of interest in materials science and medicinal chemistry. Its CAS number, 10130-23-1, is a unique identifier that facilitates the identification and study of this specific chemical substance in various databases and literature.
Formula:C15H12N2
InChI:InChI=1/C15H12N2/c1-11-15(12-7-3-2-4-8-12)17-14-10-6-5-9-13(14)16-11/h2-10H,1H3
SMILES:Cc1c(c2ccccc2)nc2ccccc2n1
Synonyms:- Quinoxaline, 2-Methyl-3-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Methyl-3-phenylquinoxaline
CAS:2-Methyl-3-phenylquinoxaline (compound 38) serves as an effective inhibitor of the Platelet-Derived Growth Factor Receptor Tyrosine Kinase (PDGF-RTK), exhibiting significant inhibitory activity against the full-length PDGFR kinase in intact cells (IC50 greater than 100 μM).Formula:C15H12N2Color and Shape:SolidMolecular weight:220.27
