CAS 10130-23-1: 2-methyl-3-phenylquinoxaline

Description:2-Methyl-3-phenylquinoxaline is an organic compound characterized by its fused bicyclic structure, which consists of a quinoxaline core with a methyl group and a phenyl group attached. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties due to the presence of the phenyl group. It is relatively stable under standard conditions but may undergo reactions typical of quinoxaline derivatives, such as electrophilic substitution or reduction. The presence of the methyl and phenyl substituents can influence its solubility, reactivity, and potential applications in organic synthesis or as a building block in pharmaceuticals. Additionally, compounds like 2-methyl-3-phenylquinoxaline may exhibit interesting photophysical properties, making them of interest in materials science and medicinal chemistry. Its CAS number, 10130-23-1, is a unique identifier that facilitates the identification and study of this specific chemical substance in various databases and literature.

Formula:C₁₅H₁₂N₂

InChI:InChI=1/C15H12N2/c1-11-15(12-7-3-2-4-8-12)17-14-10-6-5-9-13(14)16-11/h2-10H,1H3