CAS 1013027-31-0

(3Z,6aR,8R,10aS,14E)-6a,8-Dichloro-6a,7,8,9-tetrahydro-5-hydroxy-9,9,15-trimethyl-4H-10a,3-[2]hexen[1]yl[6]ylidene-2H,10aH-naphtho[2,3-b:7,6-b′]dipyran-6,11-dione

Description:

The chemical substance with the name "(3Z,6aR,8R,10aS,14E)-6a,8-Dichloro-6a,7,8,9-tetrahydro-5-hydroxy-9,9,15-trimethyl-4H-10a,3-[2]hexen[1]yl[6]ylidene-2H,10aH-naphtho[2,3-b:7,6-b′]dipyran-6,11-dione" and CAS number "1013027-31-0" is a complex organic compound characterized by its intricate polycyclic structure and multiple functional groups. It features a naphthoquinone core, which is indicative of its potential biological activity, particularly in the realm of natural products and pharmaceuticals. The presence of dichloro and hydroxy groups suggests reactivity and possible interactions with biological targets. Its stereochemistry, denoted by specific configurations at various chiral centers, may influence its pharmacokinetics and dynamics. The compound's unique structural features may contribute to its solubility, stability, and interaction with other molecules, making it of interest in medicinal chemistry and material science. Further studies would be necessary to elucidate its specific properties, including its reactivity, biological activity, and potential applications.

Formula: C₂₅H₂₆Cl₂O₅

InChI: InChI=1S/C25H26Cl2O5/c1-13-5-4-6-14-9-15-17(31-12-14)10-16-19(20(15)28)22(30)24(27)11-18(26)23(2,3)32-25(24,8-7-13)21(16)29/h6-7,10,18,28H,4-5,8-9,11-12H2,1-3H3/b13-7+,14-6-/t18-,24+,25+/m1/s1

InChI key: InChIKey=CGYXUANFCZTNCN-SYDPDMOYSA-N

SMILES: Cl[C@]12[C@]3(C(=O)C=4C(C1=O)=C(O)C5=C(C4)OC/C(/C5)=C\CC\C(\C)=C\C3)OC(C)(C)[C@H](Cl)C2

Synonyms:

• 4H-10a,3-[2]Hexen[1]yl[6]ylidene-2H,10aH-naphtho[2,3-b:7,6-b′]dipyran-6,11-dione, 6a,8-dichloro-6a,7,8,9-tetrahydro-5-hydroxy-9,9,15-trimethyl-, (3Z,6aR,8R,10aS,14E)-
• (3Z,6aR,8R,10aS,14E)-6a,8-Dichloro-6a,7,8,9-tetrahydro-5-hydroxy-9,9,15-trimethyl-4H-10a,3-[2]hexen[1]yl[6]ylidene-2H,10aH-naphtho[2,3-b:7,6-b′]dipyran-6,11-dione
• Napyradiomycin SR

Napyradiomycin sr

CAS: 1013027-31-0

Napyradiomycin SR is a specialized metabolite, classified as a secondary metabolite, derived from marine-derived actinobacteria. This bacterial source, particularly the genus Streptomyces, is renowned for its capacity to produce bioactive natural products. The mode of action of Napyradiomycin SR involves the disruption of cellular processes crucial for cancer cell proliferation. It interacts with specific molecular targets, leading to the inhibition of DNA synthesis and inducing apoptosis in malignant cells.

Formula: C₂₅H₂₆Cl₂O₅

Purity: Min. 95%

Molecular weight: 477.4 g/mol

Ref: 3D-NQB02731