CymitQuimica logo

CAS 1013074-93-5

:

(1R,2R)-2-[(2,2-Dichloroacetyl)amino]-3-hydroxy-1-(4-nitrophenyl)propyl β-D-glucopyranosiduronic acid

Description:
The chemical substance known as "(1R,2R)-2-[(2,2-Dichloroacetyl)amino]-3-hydroxy-1-(4-nitrophenyl)propyl β-D-glucopyranosiduronic acid" with CAS number 1013074-93-5 is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a glucopyranosiduronic acid backbone, which indicates the presence of a sugar moiety with a uronic acid component. The compound contains a dichloroacetyl group, contributing to its reactivity and potential biological activity. Additionally, the presence of a nitrophenyl group suggests potential applications in medicinal chemistry, possibly as a pharmacophore or in drug design. The hydroxyl group enhances its solubility and reactivity, making it suitable for various chemical reactions. Overall, this compound's unique structure and functional groups may impart specific properties, including biological activity, making it of interest in pharmaceutical research and development. Further studies would be necessary to elucidate its precise applications and mechanisms of action.
Formula:C17H20Cl2N2O11
InChI:InChI=1S/C17H20Cl2N2O11/c18-14(19)15(26)20-8(5-22)12(6-1-3-7(4-2-6)21(29)30)31-17-11(25)9(23)10(24)13(32-17)16(27)28/h1-4,8-14,17,22-25H,5H2,(H,20,26)(H,27,28)/t8-,9+,10+,11-,12-,13+,17-/m1/s1
InChI key:InChIKey=DCHLHOYWKBFSDE-IHYHKNIHSA-N
SMILES:[C@@H]([C@H](NC(C(Cl)Cl)=O)CO)(O[C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O)C2=CC=C(N(=O)=O)C=C2
Synonyms:
  • (1R,2R)-2-[(2,2-Dichloroacetyl)amino]-3-hydroxy-1-(4-nitrophenyl)propyl β-D-glucopyranosiduronic acid
  • Chloramphenicol 1-glucuronide
  • β-D-Glucopyranosiduronic acid, (1R,2R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-1-(4-nitrophenyl)propyl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.