CymitQuimica logo

CAS 10132-02-2

:

4-Phenyl-1-phthalazinecarbonitrile

Description:
4-Phenyl-1-phthalazinecarbonitrile, with the CAS number 10132-02-2, is an organic compound characterized by its unique structure, which includes a phthalazine core substituted with a phenyl group and a cyano group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. Its molecular structure contributes to its chemical reactivity, making it a candidate for further functionalization or use in synthetic pathways. The presence of the cyano group imparts notable electronic properties, which can influence its behavior in chemical reactions. Additionally, 4-Phenyl-1-phthalazinecarbonitrile may exhibit specific solubility characteristics, depending on the solvent used, and can participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices.
Formula:C15H9N3
InChI:InChI=1S/C15H9N3/c16-10-14-12-8-4-5-9-13(12)15(18-17-14)11-6-2-1-3-7-11/h1-9H
InChI key:InChIKey=QXPKRILVRQXPCB-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(C(=NN1)C3=CC=CC=C3)C=CC=C2
Synonyms:
  • 1-Phenyl-4-phthalazinecarbonitrile
  • 4-Phenyl-1-phthalazinecarbonitrile
  • 1-Phthalazinecarbonitrile, 4-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.