
CAS 1013210-87-1
:1-(4,5,6,7-Tetrahydrothieno[3,2-c]pyridin-2-yl)ethanone
Description:
1-(4,5,6,7-Tetrahydrothieno[3,2-c]pyridin-2-yl)ethanone, with the CAS number 1013210-87-1, is a chemical compound characterized by its unique bicyclic structure that incorporates both a thieno and a pyridine moiety. This compound features a tetrahydrothieno ring fused to a pyridine ring, contributing to its potential biological activity. The ethanone functional group indicates the presence of a ketone, which can influence its reactivity and interactions in various chemical environments. Typically, compounds of this nature may exhibit properties such as moderate polarity due to the presence of heteroatoms (sulfur and nitrogen) in the ring structure, which can also affect solubility in organic solvents. Additionally, the presence of the tetrahydro configuration suggests that the compound may have a degree of strain or flexibility in its conformation. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, although specific biological activities would require further investigation.
Formula:C9H11NOS
InChI:InChI=1S/C9H11NOS/c1-6(11)9-4-7-5-10-3-2-8(7)12-9/h4,10H,2-3,5H2,1H3
InChI key:InChIKey=BMTSNFPTGYEYAM-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC2=C(S1)CCNC2
Synonyms:- 1-(4,5,6,7-Tetrahydrothieno[3,2-c]pyridin-2-yl)ethanone
- Ethanone, 1-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)-
- 1-[4H,5H,6H,7H-Thieno[3,2-c]pyridin-2-yl]ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.