CAS 101327-98-4
:Methyl 1-methyl-2-oxo-3-piperidinecarboxylate
Description:
Methyl 1-methyl-2-oxo-3-piperidinecarboxylate, with the CAS number 101327-98-4, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is characterized by the presence of a methyl group and a carbonyl group adjacent to the nitrogen atom. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly as an intermediate in the development of pharmaceuticals. The presence of the ester functional group contributes to its reactivity, making it useful in various chemical reactions, such as esterification and nucleophilic substitutions. Additionally, the compound's structure suggests it may exhibit biological activity, although specific pharmacological properties would require further investigation. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H13NO3
InChI:InChI=1S/C8H13NO3/c1-9-5-3-4-6(7(9)10)8(11)12-2/h6H,3-5H2,1-2H3
InChI key:InChIKey=GFCZCYCTEGTOBA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C(=O)N(C)CCC1
Synonyms:- Methyl 1-methyl-2-oxo-3-piperidinecarboxylate
- 3-Piperidinecarboxylic acid, 1-methyl-2-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
