CAS 10133-20-7

2-(Bromomethyl)benzo[b]thiophene

Description:

2-(Bromomethyl)benzo[b]thiophene is an organic compound characterized by the presence of a bromomethyl group attached to a benzo[b]thiophene moiety. This compound features a fused ring system that includes a thiophene ring, which is a five-membered aromatic ring containing sulfur, and a benzene ring. The bromomethyl group introduces a bromine atom and a methylene (-CH2-) group, enhancing its reactivity and making it a useful intermediate in organic synthesis. The presence of the bromine atom allows for further functionalization through nucleophilic substitution reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure imparts specific electronic properties, making it of interest in materials science and medicinal chemistry. Additionally, compounds like 2-(Bromomethyl)benzo[b]thiophene can be studied for their potential biological activities, including antimicrobial or anticancer properties, although specific biological data would require further investigation. Safety precautions should be taken when handling this compound due to the presence of bromine, which can be hazardous.

Formula: C₉H₇BrS

InChI: InChI=1S/C9H7BrS/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5H,6H2

InChI key: InChIKey=HGPATVJUCMLGIY-UHFFFAOYSA-N

SMILES: C(Br)C1=CC=2C(S1)=CC=CC2

Synonyms:

• 2-(Bromomethyl)-1-benzothiophene
• 2-(Bromomethyl)benzo[b]thiophene
• Benzo[b]thiophene, 2-(bromomethyl)-

2-(bromomethyl)-1-benzothiophene

CAS: 10133-20-7

Formula: C₉H₇BrS

Molecular weight: 227.1209

Ref: IN-DA00048X