CAS 10133-30-9
:Benzo(b)thiophene-5-carboxaldehyde
Description:
Benzo(b)thiophene-5-carboxaldehyde is an organic compound characterized by its fused ring structure, which includes a benzene ring and a thiophene ring. This compound features a carboxaldehyde functional group (-CHO) at the 5-position of the thiophene ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a yellow to brown solid at room temperature and is known for its aromatic properties, which can influence its chemical behavior and interactions. The presence of the thiophene moiety imparts unique electronic properties, making it of interest in materials science, particularly in the development of organic semiconductors and photovoltaic devices. Additionally, benzo(b)thiophene-5-carboxaldehyde may exhibit biological activity, which could be explored for pharmaceutical applications. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C9H6OS
InChI:InChI=1/C9H6OS/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-6H
SMILES:c1cc2c(ccs2)cc1C=O
Synonyms:- 1-Benzothiophene-5-Carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzo[b]thiophene-5-carbaldehyde
CAS:Formula:C9H6OSPurity:98%Color and Shape:SolidMolecular weight:162.2083Benzo[b]thiophene-5-carboxaldehyde
CAS:<p>Benzo[b]thiophene-5-carboxaldehyde</p>Formula:C9H6OSPurity:≥95%Color and Shape: yellow solidMolecular weight:162.21g/molBenzo[b]thiophene-5-carbaldehyde
CAS:Formula:C9H6OSPurity:98%Color and Shape:SolidMolecular weight:162.21Benzo[b]thiophene-5-carbaldehyde
CAS:<p>Benzo[b]thiophene-5-carbaldehyde is a cytotoxic compound that is catalyzed to produce toxic metabolites. It has an agonistic effect on the nicotinic acetylcholine receptor and can be used for the treatment of nicotine addiction. Benzo[b]thiophene-5-carbaldehyde inhibits tumor cell growth in culture by inhibiting metabolic processes, including formylation, which leads to the production of stable compounds. It also has inhibitory effects on aldehyde dehydrogenase, which is involved in the conversion of glucose into glyceraldehyde 3-phosphate. This prevents glycolysis from proceeding and leads to cell death.</p>Formula:C9H6OSPurity:Min. 95%Molecular weight:162.21 g/mol



