CAS 1013333-23-7: 3-Piperidinol, 4-(aminomethyl)-, hydrochloride (1:2), (3R,4R)-rel-

Description:3-Piperidinol, 4-(aminomethyl)-, hydrochloride (1:2), (3R,4R)-rel- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a hydroxyl group (-OH) at the 3-position and an aminomethyl group (-CH2NH2) at the 4-position of the piperidine ring, contributing to its potential biological activity. The hydrochloride salt form indicates that it is combined with hydrochloric acid, enhancing its solubility in water and stability. The (3R,4R)-rel- designation refers to its specific stereochemistry, indicating that it has a particular spatial arrangement of its atoms, which can significantly influence its pharmacological properties. Such compounds are often studied for their potential therapeutic applications, particularly in the fields of neuroscience and medicinal chemistry, due to their ability to interact with various biological targets. As with many piperidine derivatives, it may exhibit properties such as analgesic, anti-inflammatory, or neuroprotective effects, although specific biological activities would require further investigation.

Formula:C₆H₁₄N₂O·2ClH

InChI:InChI=1/C6H14N2O.2ClH/c7-3-5-1-2-8-4-6(5)9;;/h5-6,8-9H,1-4,7H2;2*1H/t5-,6+;;/s2

InChI key:InChIKey=SIBYUDCKMJXCLR-LCFXNKIZNA-N

SMILES:Cl.OC1CNCCC1CN

Synonyms:
3-Piperidinol, 4-(aminomethyl)-, hydrochloride (1:2), (3R,4R)-rel-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
3-Piperidinol, 4-(aminomethyl)-, hydrochloride (1:2), (3R,4R)-rel- REF: IN-DA000492CAS: 1013333-23-7	97%	To inquire	Wed 26 Mar 25
trans-4-(aminomethyl)piperidin-3-ol dihydrochloride REF: 10-F517343CAS: 1013333-23-7	95	- - -	Discontinued product
trans-4-(Aminomethyl)-3-hydroxypiperidine dihydrochloride REF: 3D-NQB33323CAS: 1013333-23-7	Min. 95%	- - -	Discontinued product