CymitQuimica logo

CAS 1013333-59-9

:

1,1-Dimethylethyl 3,4-dihydro-5-methoxy-4-oxospiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylate

Description:
1,1-Dimethylethyl 3,4-dihydro-5-methoxy-4-oxospiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylate, with CAS number 1013333-59-9, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both a benzopyran and a piperidine moiety. This compound features a methoxy group and a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group enhances its steric bulk, which may influence its biological activity and interaction with other molecules. Typically, compounds of this nature are studied for their potential pharmacological properties, including anti-inflammatory or anticancer activities, due to the diverse biological roles of benzopyran derivatives. The compound's stability, solubility, and reactivity can be influenced by its molecular structure, making it a subject of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific properties and potential applications in various fields.
Formula:C19H25NO5
InChI:InChI=1S/C19H25NO5/c1-18(2,3)25-17(22)20-10-8-19(9-11-20)12-13(21)16-14(23-4)6-5-7-15(16)24-19/h5-7H,8-12H2,1-4H3
InChI key:InChIKey=PABSFWRFOSOOQE-UHFFFAOYSA-N
SMILES:O=C1CC2(OC=3C1=C(OC)C=CC3)CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1,1-Dimethylethyl 3,4-dihydro-5-methoxy-4-oxospiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylate
  • Spiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylic acid, 3,4-dihydro-5-methoxy-4-oxo-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.