
CAS 1013334-97-8
:1,1-Dimethylethyl 3,4-dihydro-4-oxospiro[2H-1-benzopyran-2,3′-piperidine]-1′-carboxylate
Description:
1,1-Dimethylethyl 3,4-dihydro-4-oxospiro[2H-1-benzopyran-2,3′-piperidine]-1′-carboxylate, with CAS number 1013334-97-8, is a chemical compound characterized by its complex structure that includes a spirocyclic framework. This compound features a benzopyran moiety fused to a piperidine ring, which contributes to its unique chemical properties. The presence of a carboxylate group suggests potential for reactivity and interaction with various biological systems. Additionally, the dimethyl substituents on the carbon backbone may influence its steric and electronic properties, potentially affecting its solubility and reactivity. Such compounds are often of interest in medicinal chemistry due to their potential biological activities, including anti-inflammatory or anticancer properties. The specific arrangement of functional groups and the stereochemistry of the molecule can significantly impact its pharmacological profile. Overall, this compound exemplifies the complexity and diversity of organic molecules that can be synthesized for various applications in research and industry.
Formula:C18H23NO4
InChI:InChI=1S/C18H23NO4/c1-17(2,3)23-16(21)19-10-6-9-18(12-19)11-14(20)13-7-4-5-8-15(13)22-18/h4-5,7-8H,6,9-12H2,1-3H3
InChI key:InChIKey=RKWZMXLQUJMXIX-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2(OC=3C(C(=O)C2)=CC=CC3)CCC1
Synonyms:- Spiro[2H-1-benzopyran-2,3′-piperidine]-1′-carboxylic acid, 3,4-dihydro-4-oxo-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3,4-dihydro-4-oxospiro[2H-1-benzopyran-2,3′-piperidine]-1′-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.