CymitQuimica logo

CAS 101337-93-3

:

2-Amino-7-chloro-6-fluorobenzothiazole

Description:
2-Amino-7-chloro-6-fluorobenzothiazole is a heterocyclic compound characterized by the presence of both amino and halogen functional groups attached to a benzothiazole ring system. This compound features a benzothiazole backbone, which consists of a fused benzene and thiazole ring, contributing to its aromatic properties and potential biological activity. The amino group (-NH2) at the 2-position and the chloro (-Cl) and fluoro (-F) substituents at the 7 and 6 positions, respectively, enhance its reactivity and solubility in various solvents. This compound is of interest in medicinal chemistry due to its potential applications in pharmaceuticals, particularly as a scaffold for developing antimicrobial or anticancer agents. Additionally, the presence of halogens can influence the compound's electronic properties, making it suitable for further chemical modifications. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact.
Formula:C7H4ClFN2S
InChI:InChI=1S/C7H4ClFN2S/c8-5-3(9)1-2-4-6(5)12-7(10)11-4/h1-2H,(H2,10,11)
InChI key:InChIKey=AJBFRRHGAUBCOQ-UHFFFAOYSA-N
SMILES:ClC1=C2C(N=C(N)S2)=CC=C1F
Synonyms:
  • 2-Amino-6-fluoro-7-chloro-1,3-benzothiazole
  • 7-Chloro-6-fluoro-2-benzothiazolamine
  • 2-Amino-6-fluoro-7-chlorobenzothiazole
  • 2-Amino-7-chloro-6-fluorobenzothiazole
  • 2-Benzothiazolamine, 7-chloro-6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.