
CAS 1013398-58-7
:1H-Indole, 5-chloro-2,3-dihydro-, hydrochloride (1:1)
Description:
1H-Indole, 5-chloro-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 5-position of the indole ring introduces specific reactivity and influences its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and the dihydro form suggests it may participate in further chemical transformations. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, 1H-Indole, 5-chloro-2,3-dihydro-, hydrochloride (1:1) represents a versatile compound with potential applications in research and drug development.
Formula:C8H8ClN·ClH
InChI:InChI=1S/C8H8ClN.ClH/c9-7-1-2-8-6(5-7)3-4-10-8;/h1-2,5,10H,3-4H2;1H
InChI key:InChIKey=PUGXFVNHRAMBQK-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=CC1)NCC2.Cl
Synonyms:- 1H-Indole, 5-chloro-2,3-dihydro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
