CAS 10134-98-2

Benzo[b]thiophene-7-carboxylic acid

Description:

Benzo[b]thiophene-7-carboxylic acid is an organic compound characterized by its fused ring structure, which includes a benzene ring and a thiophene ring. This compound features a carboxylic acid functional group (-COOH) at the 7-position of the benzo[b]thiophene framework, contributing to its acidic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals and as a building block for more complex molecules. Its unique structure allows for various chemical modifications, making it a versatile intermediate in synthetic chemistry. Additionally, benzo[b]thiophene derivatives are known for their biological activities, which may include antimicrobial and anti-inflammatory properties, although specific biological data for this compound may vary. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₉H₆O₂S

InChI: InChI=1S/C9H6O2S/c10-9(11)7-3-1-2-6-4-5-12-8(6)7/h1-5H,(H,10,11)

InChI key: InChIKey=LJPSRTWIAXVPIS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C=CS2)=CC=C1

Synonyms:

• Benzo[b]thiophene-7-carboxylic acid
• Benzo[b]thiophene-7-carboxylic acid 97%
• Benzothiophene-7-carboxylic acid
• 1-Benzothiophene-7-carboxylic acid

Benzo[b]thiophene-7-carboxylic acid

CAS: 10134-98-2

Formula: C₉H₆O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.2077

Ref: IN-DA0004AB

Benzo[b]thiophene-7-carboxylic acid

CAS: 10134-98-2

Benzo[b]thiophene-7-carboxylic acid

Formula: C₉H₆O₂S

Purity: 97%

Color and Shape: pale yellow to pale brown powder

Molecular weight: 178.21g/mol

Ref: 54-OR12294

Benzo[b]thiophene-7-carboxylic acid

CAS: 10134-98-2

Formula: C₉H₆O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.21

Ref: 10-F242974

Benzo[b]thiophene-7-carboxylic acid

CAS: 10134-98-2

Benzo[b]thiophene-7-carboxylic acid is a versatile compound that has various applications in the field of research. It is commonly used as a precursor or intermediate in the synthesis of different compounds, including carbostyril derivatives and nitro-substituted benzo[b]thiophenes. This compound has also been utilized as a fluorescent probe for detecting gamma-aminobutyric acid (GABA) receptors and studying their binding affinity.

Formula: C₉H₆O₂S

Purity: Min. 95%

Molecular weight: 178.21 g/mol

Ref: 3D-KAA13498