CAS 101345-66-8
:N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-2-furancarboxamide
Description:
N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-2-furancarboxamide, with CAS number 101345-66-8, is a synthetic compound that belongs to the class of piperidine derivatives. This substance features a complex molecular structure characterized by a piperidine ring, a phenyl group, and a furan moiety, which contribute to its unique chemical properties. It is typically studied for its potential pharmacological applications, particularly in the field of neuroscience and medicinal chemistry. The presence of the furan ring may impart specific reactivity and solubility characteristics, while the piperidine and phenyl groups can influence its interaction with biological targets. The compound is likely to exhibit moderate to high lipophilicity, which can affect its bioavailability and distribution in biological systems. As with many synthetic organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated through rigorous testing to determine its suitability for therapeutic use.
Formula:C24H26N2O2
InChI:InChI=1S/C24H26N2O2/c27-24(23-12-7-19-28-23)26(21-10-5-2-6-11-21)22-14-17-25(18-15-22)16-13-20-8-3-1-4-9-20/h1-12,19,22H,13-18H2
InChI key:InChIKey=FZJVHWISUGFFQV-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CO1)(C2CCN(CCC3=CC=CC=C3)CC2)C4=CC=CC=C4
Synonyms:- 2-Furancarboxamide, N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-
- Furanylfentanyl
- N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-2-furancarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.