
CAS 10135-01-0
:3-Bromobenzo[b]thiophene-5-carboxaldehyde
Description:
3-Bromobenzo[b]thiophene-5-carboxaldehyde is an organic compound characterized by its unique structure, which includes a bromine atom, a thiophene ring, and an aldehyde functional group. This compound features a fused bicyclic system that combines a benzene ring with a thiophene, contributing to its aromatic properties and potential reactivity. The presence of the bromine substituent enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The aldehyde group is a reactive functional group that can participate in condensation reactions and can be further transformed into other functional groups. This compound is of interest in organic synthesis and materials science, particularly in the development of organic semiconductors and pharmaceuticals. Its properties, such as solubility and stability, can vary depending on the solvent and conditions used. Overall, 3-Bromobenzo[b]thiophene-5-carboxaldehyde serves as a valuable building block in synthetic organic chemistry.
Formula:C9H5BrOS
InChI:InChI=1S/C9H5BrOS/c10-8-5-12-9-2-1-6(4-11)3-7(8)9/h1-5H
InChI key:InChIKey=NPIRZCZZCDSQGV-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC=C(C=O)C2)SC1
Synonyms:- 3-Bromobenzo[b]thiophene-5-carboxaldehyde
- 3-Bromo-1-benzothiophene-5-carbaldehyde
- Benzo[b]thiophene-5-carboxaldehyde, 3-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.