CAS 10135-02-1

3-Bromobenzo[b]thiophene-6-carboxaldehyde

Description:

3-Bromobenzo[b]thiophene-6-carboxaldehyde is an organic compound characterized by its unique structure, which includes a bromine atom, a thiophene ring, and an aldehyde functional group. This compound features a fused benzene and thiophene system, contributing to its aromatic properties and potential reactivity. The presence of the bromine substituent enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The aldehyde group allows for further functionalization, enabling the synthesis of more complex molecules. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, 3-Bromobenzo[b]thiophene-6-carboxaldehyde is a valuable compound in synthetic organic chemistry, with applications in material science and medicinal chemistry due to its versatile reactivity and structural features.

Formula: C₉H₅BrOS

InChI: InChI=1S/C9H5BrOS/c10-8-5-12-9-3-6(4-11)1-2-7(8)9/h1-5H

InChI key: InChIKey=HYAFDAJACJBSBO-UHFFFAOYSA-N

SMILES: BrC=1C=2C(=CC(C=O)=CC2)SC1

Synonyms:

• 3-Bromo-1-benzothiophene-6-carboxaldehyde
• Benzo[b]thiophene-6-carboxaldehyde, 3-bromo-
• 3-Bromobenzo[b]thiophene-6-carboxaldehyde
• 3-Bromo-1-benzothiophene-6-carbaldehyde