CAS 101353-61-1
:endo-N-Benzyl-endo-3-aminotropane
Description:
Endo-N-Benzyl-endo-3-aminotropane, identified by its CAS number 101353-61-1, is a chemical compound that belongs to the class of tropanes, which are bicyclic compounds containing a nitrogen atom. This substance features a benzyl group attached to the nitrogen atom, contributing to its unique properties. It is characterized by its endo configuration, which refers to the orientation of substituents in the bicyclic structure. The presence of the amino group enhances its potential for biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit interactions with neurotransmitter systems, particularly those involving dopamine and norepinephrine, due to its structural similarities to other psychoactive tropane derivatives. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many chemical substances, safety and handling precautions are essential, given the potential for biological activity and toxicity. Further research is often necessary to fully elucidate its pharmacological properties and applications.
Formula:C15H22N2
InChI:InChI=1/C15H22N2/c1-17-14-7-8-15(17)10-13(9-14)16-11-12-5-3-2-4-6-12/h2-6,13-16H,7-11H2,1H3
SMILES:CN1C2CCC1CC(C2)NCc1ccccc1
Synonyms:- N-benzyl-8-methyl-8-azabicyclo[3.2.1]octan-3-amine
- endo- N-benzyl-endo-3-aminotropane
- endo-N-Benzyl-8-Methyl-8-azabicyclo[3.2.1]octan-3-aMine
- 8-Azabicyclo[3.2.1]octan-3-amine,8-methyl-N-(phenylmethyl)-
- Tropane,3-benzylamino- (6CI)
- 3-Benzylamine-tropane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
