CymitQuimica logo

CAS 101371-00-0

:

2-Butanone, 2,2′,2′′-[O,O′,O′′-(ethoxysilylidyne)trioxime]

Description:
2-Butanone, 2,2′,2′′-[O,O′,O′′-(ethoxysilylidyne)trioxime], with CAS number 101371-00-0, is a chemical compound that features a butanone backbone modified with a silane functional group. This compound is characterized by the presence of a trioxime functional group, which typically enhances its reactivity and potential applications in various chemical processes. The ethoxysilylidyne moiety suggests that it may exhibit properties related to silane chemistry, such as adhesion, surface modification, or as a coupling agent in polymer formulations. The presence of multiple functional groups indicates that it may participate in diverse chemical reactions, including condensation and cross-linking. Additionally, the compound's structure implies potential applications in materials science, particularly in the development of coatings, adhesives, or composites. Its specific physical and chemical properties, such as solubility, boiling point, and reactivity, would depend on the overall molecular structure and the interactions between its functional groups.
Formula:C14H29N3O4Si
InChI:InChI=1S/C14H29N3O4Si/c1-8-12(5)15-19-22(18-11-4,20-16-13(6)9-2)21-17-14(7)10-3/h8-11H2,1-7H3
InChI key:InChIKey=YCMWPOSJKIPEMT-UHFFFAOYSA-N
SMILES:[Si](ON=C(CC)C)(ON=C(CC)C)(ON=C(CC)C)OCC
Synonyms:
  • 2-Butanone, 2,2′,2′′-[O,O′,O′′-(ethoxysilylidyne)trioxime]
  • 2-Butanone, O,O′,O′′-(ethoxysilylidyne)trioxime
  • Ethoxytris(ethylmethylketoximo)silane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.