CymitQuimica logo

CAS 101371-01-1

:

2-Butanone, O-(triethoxysilyl)oxime

Description:
2-Butanone, O-(triethoxysilyl)oxime, also known by its CAS number 101371-01-1, is a chemical compound characterized by the presence of both a ketone and an oxime functional group, along with a triethoxysilyl moiety. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. Its structure features a butanone backbone, which contributes to its reactivity, particularly in condensation reactions. The triethoxysilyl group enhances its compatibility with silicate materials, making it useful in applications such as adhesion promotion and surface modification. The oxime functionality can participate in various chemical reactions, including those involving nucleophiles, making it valuable in synthetic organic chemistry. Additionally, this compound may exhibit properties such as low volatility and moderate viscosity, which can influence its handling and application in industrial processes. Overall, 2-Butanone, O-(triethoxysilyl)oxime is significant in the fields of materials science and surface chemistry due to its unique chemical properties and functional versatility.
Formula:C10H23NO4Si
InChI:InChI=1S/C10H23NO4Si/c1-6-10(5)11-15-16(12-7-2,13-8-3)14-9-4/h6-9H2,1-5H3
InChI key:InChIKey=QQDVURZPCZXMLQ-UHFFFAOYSA-N
SMILES:[Si](ON=C(CC)C)(OCC)(OCC)OCC
Synonyms:
  • 2-Butanone, O-(triethoxysilyl)oxime
  • (Butan-2-ylideneamino) triethyl silicate
  • Triethoxy(ethylmethylketoximo)silane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.