CymitQuimica logo

CAS 101377-33-7

:

1,27-Bis(2-oxiranyl)-8,16,24-tris(2-oxiranylmethoxy)-2,6,10,14,18,22,26-heptaoxaheptacosane-4,12,20-triol

Description:
1,27-Bis(2-oxiranyl)-8,16,24-tris(2-oxiranylmethoxy)-2,6,10,14,18,22,26-heptaoxaheptacosane-4,12,20-triol, with CAS number 101377-33-7, is a complex organic compound characterized by its extensive polyether structure. This substance features multiple epoxide (oxirane) groups, which contribute to its reactivity and potential applications in polymer chemistry and materials science. The presence of multiple ether linkages enhances its solubility in various organic solvents and may impart unique properties such as flexibility and thermal stability. The compound's structure suggests it could be utilized in the synthesis of advanced materials, including surfactants or as a precursor for more complex polymeric systems. Additionally, the hydroxyl groups present in the molecule may facilitate hydrogen bonding, influencing its physical properties and interactions with other substances. Overall, this compound exemplifies the intricate nature of synthetic organic chemistry, with potential implications in various industrial applications.
Formula:C33H58O18
InChI:InChI=1S/C33H58O18/c34-23(2-38-9-27(45-18-32-21-50-32)10-40-5-25(36)6-42-13-29-15-47-29)1-37-7-26(44-17-31-20-49-31)8-39-3-24(35)4-41-11-28(46-19-33-22-51-33)12-43-14-30-16-48-30/h23-36H,1-22H2
InChI key:InChIKey=PGPNHSXRNWRZOB-UHFFFAOYSA-N
SMILES:C(OC(COCC1CO1)COCC(COCC(OCC2CO2)COCC(COCC(OCC3CO3)COCC(COCC4CO4)O)O)O)C5CO5
Synonyms:
  • 1,27-Bis(oxiranyl)-8,16,24-tris(oxiranylmethoxy)-2,6,10,14,18,22,26-heptaoxaheptacosane-4,12,20-triol
  • 2,6,10,14,18,22,26-Heptaoxaheptacosane-4,12,20-triol, 1,27-bis(oxiranyl)-8,16,24-tris(oxiranylmethoxy)-
  • 1,27-Bis(2-oxiranyl)-8,16,24-tris(2-oxiranylmethoxy)-2,6,10,14,18,22,26-heptaoxaheptacosane-4,12,20-triol
  • 2,6,10,14,18,22,26-Heptaoxaheptacosane-4,12,20-triol, 1,27-bis(2-oxiranyl)-8,16,24-tris(2-oxiranylmethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.