CAS 101377-47-3
:4-[[Bis(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole
Description:
4-[[Bis(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole, with CAS number 101377-47-3, is a chemical compound characterized by its unique structure that includes a triazole ring and a silyl group. The presence of the bis(4-fluorophenyl)methylsilyl moiety suggests that it has significant steric and electronic properties, which may influence its reactivity and interactions with other molecules. This compound is likely to exhibit properties typical of triazoles, such as potential antifungal or herbicidal activity, due to the triazole ring's ability to coordinate with metal ions and its role in biological systems. Additionally, the fluorinated phenyl groups may enhance lipophilicity and stability, making it suitable for various applications in pharmaceuticals or agrochemicals. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its structure and purity. Overall, this compound represents a class of organosilicon compounds with potential utility in diverse chemical applications.
Formula:C16H15F2N3Si
InChI:InChI=1S/C16H15F2N3Si/c1-22(12-21-10-19-20-11-21,15-6-2-13(17)3-7-15)16-8-4-14(18)5-9-16/h2-11H,12H2,1H3
InChI key:InChIKey=UHFBTGZSQCBFKK-UHFFFAOYSA-N
SMILES:[Si](CN1C=NN=C1)(C)(C2=CC=C(F)C=C2)C3=CC=C(F)C=C3
Synonyms:- 4H-1,2,4-Triazole, 4-[[bis(4-fluorophenyl)methylsilyl]methyl]-
- 4-[[Bis(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole
- (1,2,4-Triazol-4-ylmethyl)bis(4-fluorophenyl)methylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
