CAS 10138-46-2
:Acetoacetyl ethanolamine
Description:
Acetoacetyl ethanolamine, with the CAS number 10138-46-2, is an organic compound characterized by its functional groups, which include an acetoacetyl moiety and an ethanolamine structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its ability to participate in various chemical reactions, particularly in the synthesis of more complex molecules, due to the presence of both ketone and amine functionalities. Acetoacetyl ethanolamine can act as a building block in organic synthesis, especially in the production of pharmaceuticals and agrochemicals. Its reactivity is influenced by the electron-withdrawing nature of the acetoacetyl group, which can enhance nucleophilicity at the amine site. Additionally, it may exhibit solubility in polar solvents, making it useful in various applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H11NO2
InChI:InChI=1/C6H11NO2/c1-3-7-6(9)4-5(2)8/h3-4H2,1-2H3,(H,7,9)
InChI key:InChIKey=REYAJCIAOQNQTF-UHFFFAOYSA-N
SMILES:C(C(NCC)=O)C(C)=O
Synonyms:- Acetoacetamide, N-ethyl-
- Brn 1754233
- Butanamide, N-ethyl-3-oxo-
- Butanamide, N-ethyl-3-oxo- (9CI)
- Ethylamid kyseliny acetoctove
- Ethylamid kyseliny acetoctove [Czech]
- N-Ethyl acetoacetamide
- N-Ethyl-3-oxobutanamide
- N-Ethylacetoacetamide
- 4-04-00-00409 (Beilstein Handbook Reference)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
