CAS 10138-74-6

2-[(2-Amino-1-methylethyl)amino]ethanol

Description:

2-[(2-Amino-1-methylethyl)amino]ethanol, also known as AEEA (Aminoethylethanolamine), is an organic compound characterized by its amino alcohol structure. It features two amino groups and a hydroxyl group, which contribute to its basicity and potential for hydrogen bonding. This compound is typically a colorless to pale yellow liquid with a characteristic amine odor. It is soluble in water and polar organic solvents, making it versatile for various applications. AEEA is primarily used in the production of surfactants, corrosion inhibitors, and as a chelating agent in various industrial processes. Its chemical properties allow it to interact with metal ions, enhancing its utility in formulations for water treatment and metal processing. Additionally, due to its amino groups, it can participate in various chemical reactions, including those involving acylation and alkylation. Safety considerations include handling it with care, as it can be irritating to the skin and eyes, and appropriate personal protective equipment should be used during its handling.

Formula: C₅H₁₄N₂O

InChI: InChI=1S/C5H14N2O/c1-5(4-6)7-2-3-8/h5,7-8H,2-4,6H2,1H3

InChI key: InChIKey=QLSQYTKEUVPIJA-UHFFFAOYSA-N

SMILES: C(NCCO)(CN)C

Synonyms:

• Ethanol, 2-[(2-amino-1-methylethyl)amino]-
• 2-[(2-Amino-1-methylethyl)amino]ethanol
• 2-(1-Aminopropan-2-ylamino)ethanol
• 2-[(1-Aminopropan-2-yl)amino]ethan-1-ol